C14H22O9S2 — CID 174759874
3-[3-(2-methylprop-2-enoyloxysulfonyl)propoxysulfonyl]propyl 2-methylprop-2-enoate (PubChem CID 174759874) has the molecular formula C14H22O9S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-[3-(2-methylprop-2-enoyloxysulfonyl)propoxysulfonyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[3-(2-methylprop-2-enoyloxysulfonyl)propoxysulfonyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174759874 |
| Molecular Formula | C14H22O9S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-[3-(2-methylprop-2-enoyloxysulfonyl)propoxysulfonyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)OCCCS(=O)(=O)OC(=O)C(=C)C |
| InChI | InChI=1S/C14H22O9S2/c1-11(2)13(15)21-7-5-9-24(17,18)22-8-6-10-25(19,20)23-14(16)12(3)4/h1,3,5-10H2,2,4H3 |
| InChIKey | MKYNXNBHZWFQIX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|