C8H12F3NO6S2 — CID 58364089
3-(trifluoromethylsulfonylsulfamoyl)propyl 2-methylprop-2-enoate (PubChem CID 58364089) has the molecular formula C8H12F3NO6S2 and a molecular weight of 339.31 g/mol. Its IUPAC name is 3-(trifluoromethylsulfonylsulfamoyl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(trifluoromethylsulfonylsulfamoyl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58364089 |
| Molecular Formula | C8H12F3NO6S2 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 3-(trifluoromethylsulfonylsulfamoyl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO6S2/c1-6(2)7(13)18-4-3-5-19(14,15)12-20(16,17)8(9,10)11/h12H,1,3-5H2,2H3 |
| InChIKey | SAWYOHUIOZOWFC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|