C7H6F5NO7S2 — CID 88582496
[2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetyl] 2-methylprop-2-enoate (PubChem CID 88582496) has the molecular formula C7H6F5NO7S2 and a molecular weight of 375.25 g/mol. Its IUPAC name is [2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88582496 |
| Molecular Formula | C7H6F5NO7S2 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | [2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(=O)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H6F5NO7S2/c1-3(2)4(14)20-5(15)6(8,9)21(16,17)13-22(18,19)7(10,11)12/h13H,1H2,2H3 |
| InChIKey | OLVGVEHJRSDXLZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|