C7H10F3NO6S2 — CID 88911957
2-(trifluoromethylsulfonylsulfamoyl)ethyl 2-methylprop-2-enoate (PubChem CID 88911957) has the molecular formula C7H10F3NO6S2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonylsulfamoyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(trifluoromethylsulfonylsulfamoyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88911957 |
| Molecular Formula | C7H10F3NO6S2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-(trifluoromethylsulfonylsulfamoyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO6S2/c1-5(2)6(12)17-3-4-18(13,14)11-19(15,16)7(8,9)10/h11H,1,3-4H2,2H3 |
| InChIKey | YEQOUWDOLROIDH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|