C7H8F5NO4S — CID 88560044
(1,1,2,2,2-pentafluoroethylsulfonylamino)methyl 2-methylprop-2-enoate (PubChem CID 88560044) has the molecular formula C7H8F5NO4S and a molecular weight of 297.20 g/mol. Its IUPAC name is (1,1,2,2,2-pentafluoroethylsulfonylamino)methyl 2-methylprop-2-enoate.
| Compound Name | (1,1,2,2,2-pentafluoroethylsulfonylamino)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88560044 |
| Molecular Formula | C7H8F5NO4S |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (1,1,2,2,2-pentafluoroethylsulfonylamino)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F5NO4S/c1-4(2)5(14)17-3-13-18(15,16)7(11,12)6(8,9)10/h13H,1,3H2,2H3 |
| InChIKey | KCJHVQYLWZPTMT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|