C14H18F5NO4S — CID 87413060
[5-[(1,1,2,2,2-pentafluoroethylsulfonylamino)methyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 87413060) has the molecular formula C14H18F5NO4S and a molecular weight of 391.36 g/mol. Its IUPAC name is [5-[(1,1,2,2,2-pentafluoroethylsulfonylamino)methyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [5-[(1,1,2,2,2-pentafluoroethylsulfonylamino)methyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87413060 |
| Molecular Formula | C14H18F5NO4S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [5-[(1,1,2,2,2-pentafluoroethylsulfonylamino)methyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1CC2CNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H18F5NO4S/c1-7(2)12(21)24-11-5-8-3-9(11)4-10(8)6-20-25(22,23)14(18,19)13(15,16)17/h8-11,20H,1,3-6H2,2H3 |
| InChIKey | KSNICNXHLAEMGD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|