C12H17IO2 — CID 163926721
[5-(iodomethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 163926721) has the molecular formula C12H17IO2 and a molecular weight of 320.17 g/mol. Its IUPAC name is [5-(iodomethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [5-(iodomethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163926721 |
| Molecular Formula | C12H17IO2 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | [5-(iodomethyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1CC2CI |
| InChI | InChI=1S/C12H17IO2/c1-7(2)12(14)15-11-5-8-3-9(11)4-10(8)6-13/h8-11H,1,3-6H2,2H3 |
| InChIKey | RFDBFEXHSUAOTL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|