C15H17F6IO3 — CID 170046372
[5-[3,3,3-trifluoro-2-iodooxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 170046372) has the molecular formula C15H17F6IO3 and a molecular weight of 486.19 g/mol. Its IUPAC name is [5-[3,3,3-trifluoro-2-iodooxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [5-[3,3,3-trifluoro-2-iodooxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170046372 |
| Molecular Formula | C15H17F6IO3 |
| Molecular Weight | 486.19 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | [5-[3,3,3-trifluoro-2-iodooxy-2-(trifluoromethyl)propyl]-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1CC2CC(OI)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H17F6IO3/c1-7(2)12(23)24-11-5-8-3-9(11)4-10(8)6-13(25-22,14(16,17)18)15(19,20)21/h8-11H,1,3-6H2,2H3 |
| InChIKey | QNALNJCYBVQQNG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.19 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|