C15H21F3O3 — CID 59616257
[5-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate (PubChem CID 59616257) has the molecular formula C15H21F3O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is [5-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate.
| Compound Name | [5-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59616257 |
| Molecular Formula | C15H21F3O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [5-(3,3,3-trifluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1CC2CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O3/c1-8(2)13(19)21-12-6-9-4-10(12)5-11(9)7-14(3,20)15(16,17)18/h9-12,20H,1,4-7H2,2-3H3 |
| InChIKey | HEYSJJZJUBTUNA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|