C15H23F3O4 — CID 129118471
[2-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclobutyl] 2-methylprop-2-enoate (PubChem CID 129118471) has the molecular formula C15H23F3O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is [2-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclobutyl] 2-methylprop-2-enoate.
| Compound Name | [2-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclobutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118471 |
| Molecular Formula | C15H23F3O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [2-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC1C(C)(C)OCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H23F3O4/c1-9(2)12(19)22-11-7-6-10(11)13(3,4)21-8-14(5,20)15(16,17)18/h10-11,20H,1,6-8H2,2-5H3 |
| InChIKey | NXFRGLKEEIWRMB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|