C18H24F6O2 — CID 58819273
[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-methylprop-2-enoate (PubChem CID 58819273) has the molecular formula C18H24F6O2 and a molecular weight of 386.38 g/mol. Its IUPAC name is [4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-methylprop-2-enoate.
| Compound Name | [4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58819273 |
| Molecular Formula | C18H24F6O2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(C(C)(C(F)(F)F)C(F)(F)F)C2CCCCC12 |
| InChI | InChI=1S/C18H24F6O2/c1-10(2)15(25)26-14-9-8-13(11-6-4-5-7-12(11)14)16(3,17(19,20)21)18(22,23)24/h11-14H,1,4-9H2,2-3H3 |
| InChIKey | BHQQHNNOPGGPGZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|