C16H20F6O3 — CID 58695475
[1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl] 2-methylprop-2-enoate (PubChem CID 58695475) has the molecular formula C16H20F6O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is [1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58695475 |
| Molecular Formula | C16H20F6O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CCCCC2C1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H20F6O3/c1-8(2)13(23)25-11-7-9-5-3-4-6-10(9)12(11)14(24,15(17,18)19)16(20,21)22/h9-12,24H,1,3-7H2,2H3 |
| InChIKey | AESHCDGKCJHJIU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|