C18H25F6IO3 — CID 138474334
[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-iodo-2-methylbutanoate (PubChem CID 138474334) has the molecular formula C18H25F6IO3 and a molecular weight of 530.29 g/mol. Its IUPAC name is [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-iodo-2-methylbutanoate.
| Compound Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 138474334 |
| Molecular Formula | C18H25F6IO3 |
| Molecular Weight | 530.29 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | [4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1CCC(C(O)(C(F)(F)F)C(F)(F)F)C2CCCCC12 |
| InChI | InChI=1S/C18H25F6IO3/c1-3-15(2,25)14(26)28-13-9-8-12(10-6-4-5-7-11(10)13)16(27,17(19,20)21)18(22,23)24/h10-13,27H,3-9H2,1-2H3 |
| InChIKey | LCVJYYLIAPAMTI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.29 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|