C17H25IO3 — CID 129168602
(9-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-iodo-2-methylbutanoate (PubChem CID 129168602) has the molecular formula C17H25IO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is (9-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-iodo-2-methylbutanoate.
| Compound Name | (9-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 129168602 |
| Molecular Formula | C17H25IO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (9-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1CC2CC1C1C3CC(O)C(C3)C21 |
| InChI | InChI=1S/C17H25IO3/c1-3-17(2,18)16(20)21-13-7-9-5-11(13)15-8-4-10(14(9)15)12(19)6-8/h8-15,19H,3-7H2,1-2H3 |
| InChIKey | YORZFOONDRUUHX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|