C22H35IO4 — CID 139357138
[4,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-iodo-2-methylbutanoate (PubChem CID 139357138) has the molecular formula C22H35IO4 and a molecular weight of 490.42 g/mol. Its IUPAC name is [4,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-iodo-2-methylbutanoate.
| Compound Name | [4,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 139357138 |
| Molecular Formula | C22H35IO4 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [4,6-bis(1-hydroxycyclopentyl)-2-bicyclo[2.2.1]heptanyl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1CC2(C3(O)CCCC3)CC1C(C1(O)CCCC1)C2 |
| InChI | InChI=1S/C22H35IO4/c1-3-19(2,23)18(24)27-17-14-20(22(26)10-6-7-11-22)12-15(17)16(13-20)21(25)8-4-5-9-21/h15-17,25-26H,3-14H2,1-2H3 |
| InChIKey | LIQPXWJIMVNFGP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|