C17H29IO2 — CID 134565456
3-(2-bicyclo[2.2.1]heptanyl)pentan-3-yl 2-iodo-2-methylbutanoate (PubChem CID 134565456) has the molecular formula C17H29IO2 and a molecular weight of 392.32 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]heptanyl)pentan-3-yl 2-iodo-2-methylbutanoate.
| Compound Name | 3-(2-bicyclo[2.2.1]heptanyl)pentan-3-yl 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 134565456 |
| Molecular Formula | C17H29IO2 |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]heptanyl)pentan-3-yl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC(CC)(CC)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H29IO2/c1-5-16(4,18)15(19)20-17(6-2,7-3)14-11-12-8-9-13(14)10-12/h12-14H,5-11H2,1-4H3 |
| InChIKey | FSSMAQRWJDWUHT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|