C16H30O2 — CID 123922780
2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl 2-methylpropanoate;ethane (PubChem CID 123922780) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl 2-methylpropanoate;ethane.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl 2-methylpropanoate;ethane |
|---|---|
| PubChem CID | 123922780 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl 2-methylpropanoate;ethane |
| SMILES | CC.CC(C)C(=O)OC(C)(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C14H24O2.C2H6/c1-9(2)13(15)16-14(3,4)12-8-10-5-6-11(12)7-10;1-2/h9-12H,5-8H2,1-4H3;1-2H3 |
| InChIKey | CHGYYJHEWMZJLK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |