C17H24O5 — CID 118503786
[3-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yloxy]-2,3-dioxopropyl] 2-methylprop-2-enoate (PubChem CID 118503786) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [3-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yloxy]-2,3-dioxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yloxy]-2,3-dioxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118503786 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [3-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yloxy]-2,3-dioxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)C(=O)OC(C)(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C17H24O5/c1-10(2)15(19)21-9-14(18)16(20)22-17(3,4)13-8-11-5-6-12(13)7-11/h11-13H,1,5-9H2,2-4H3 |
| InChIKey | UJOZDCRSLXYNEP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|