C15H18F6O2 — CID 87940851
[2-(2-bicyclo[2.2.1]heptanyl)-4,4,4-trifluorobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 87940851) has the molecular formula C15H18F6O2 and a molecular weight of 344.30 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanyl)-4,4,4-trifluorobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanyl)-4,4,4-trifluorobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 87940851 |
| Molecular Formula | C15H18F6O2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanyl)-4,4,4-trifluorobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(CC(F)(F)F)C1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C15H18F6O2/c1-8(15(19,20)21)12(22)23-13(2,7-14(16,17)18)11-6-9-3-4-10(11)5-9/h9-11H,1,3-7H2,2H3 |
| InChIKey | TTYXJWLIMHXFGT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|