C15H16F8O3 — CID 89354022
[2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 89354022) has the molecular formula C15H16F8O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 89354022 |
| Molecular Formula | C15H16F8O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(OCC1CC2CCC1C2)(C(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H16F8O3/c1-7(14(18,19)20)11(24)26-13(12(16)17,15(21,22)23)25-6-10-5-8-2-3-9(10)4-8/h8-10,12H,1-6H2 |
| InChIKey | MPPBOHLQMGXUQS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|