C15H19F5O3 — CID 89354021
[2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-methylprop-2-enoate (PubChem CID 89354021) has the molecular formula C15H19F5O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89354021 |
| Molecular Formula | C15H19F5O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanylmethoxy)-1,1,1,3,3-pentafluoropropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OCC1CC2CCC1C2)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H19F5O3/c1-8(2)12(21)23-14(13(16)17,15(18,19)20)22-7-11-6-9-3-4-10(11)5-9/h9-11,13H,1,3-7H2,2H3 |
| InChIKey | PHXABMGXGVDDBE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|