C16H27NO3 — CID 122597621
2-(2-bicyclo[2.2.1]heptanylmethylamino)oxybutyl 2-methylprop-2-enoate (PubChem CID 122597621) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethylamino)oxybutyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethylamino)oxybutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122597621 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethylamino)oxybutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)ONCC1CC2CCC1C2 |
| InChI | InChI=1S/C16H27NO3/c1-4-15(10-19-16(18)11(2)3)20-17-9-14-8-12-5-6-13(14)7-12/h12-15,17H,2,4-10H2,1,3H3 |
| InChIKey | UFLZSMPRMVHFQP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|