C12H19NO2 — CID 98153784
N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-oxobutanamide (PubChem CID 98153784) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-oxobutanamide.
| Compound Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 98153784 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C12H19NO2/c1-8(14)4-12(15)13-7-11-6-9-2-3-10(11)5-9/h9-11H,2-7H2,1H3,(H,13,15)/t9-,10-,11+/m1/s1 |
| InChIKey | UBZVWTKLJJOTIE-MXWKQRLJSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|