C12H19N3O — CID 63682985
2-(2-bicyclo[2.2.1]heptanylmethylamino)-N-(cyanomethyl)acetamide (PubChem CID 63682985) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethylamino)-N-(cyanomethyl)acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethylamino)-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 63682985 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethylamino)-N-(cyanomethyl)acetamide |
| SMILES | N#CCNC(=O)CNCC1CC2CCC1C2 |
| InChI | InChI=1S/C12H19N3O/c13-3-4-15-12(16)8-14-7-11-6-9-1-2-10(11)5-9/h9-11,14H,1-2,4-8H2,(H,15,16) |
| InChIKey | QKBWGCCTSYZGCU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|