C13H20N2O — CID 55209376
2-(2-bicyclo[2.2.1]heptanyl)-N-(3-cyanopropyl)acetamide (PubChem CID 55209376) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-(3-cyanopropyl)acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-(3-cyanopropyl)acetamide |
|---|---|
| PubChem CID | 55209376 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-(3-cyanopropyl)acetamide |
| SMILES | N#CCCCNC(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C13H20N2O/c14-5-1-2-6-15-13(16)9-12-8-10-3-4-11(12)7-10/h10-12H,1-4,6-9H2,(H,15,16) |
| InChIKey | ZAUUZVZLNOPMKQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|