C13H23NO — CID 78784658
2-(2-bicyclo[2.2.1]heptanyl)-N-butylacetamide (PubChem CID 78784658) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-butylacetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-butylacetamide |
|---|---|
| PubChem CID | 78784658 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-butylacetamide |
| SMILES | CCCCNC(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C13H23NO/c1-2-3-6-14-13(15)9-12-8-10-4-5-11(12)7-10/h10-12H,2-9H2,1H3,(H,14,15) |
| InChIKey | GILWRXKPFOBQCL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|