C13H25ClN2O — CID 119504552
2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride (PubChem CID 119504552) has the molecular formula C13H25ClN2O and a molecular weight of 260.81 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119504552 |
| Molecular Formula | C13H25ClN2O |
| Molecular Weight | 260.81 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-[2-(ethylamino)ethyl]acetamide;hydrochloride |
| SMILES | CCNCCNC(=O)CC1CC2CCC1C2.Cl |
| InChI | InChI=1S/C13H24N2O.ClH/c1-2-14-5-6-15-13(16)9-12-8-10-3-4-11(12)7-10;/h10-12,14H,2-9H2,1H3,(H,15,16);1H |
| InChIKey | DPPMPFQHGYEGMD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.81 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|