C9H15NS2 — CID 71388255
2-bicyclo[2.2.1]heptanylmethylcarbamodithioic acid (PubChem CID 71388255) has the molecular formula C9H15NS2 and a molecular weight of 201.36 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanylmethylcarbamodithioic acid.
| Compound Name | 2-bicyclo[2.2.1]heptanylmethylcarbamodithioic acid |
|---|---|
| PubChem CID | 71388255 |
| Molecular Formula | C9H15NS2 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanylmethylcarbamodithioic acid |
| SMILES | S=C(S)NCC1CC2CCC1C2 |
| InChI | InChI=1S/C9H15NS2/c11-9(12)10-5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H2,10,11,12) |
| InChIKey | IQGRRUGQOJEWQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|