C12H22N2S — CID 124868104
1-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-propylthiourea (PubChem CID 124868104) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-propylthiourea.
| Compound Name | 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 124868104 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NC[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H22N2S/c1-2-5-13-12(15)14-8-11-7-9-3-4-10(11)6-9/h9-11H,2-8H2,1H3,(H2,13,14,15)/t9-,10-,11+/m0/s1 |
| InChIKey | NFUAHOFRICDJBM-GARJFASQSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|