C15H19FN2S — CID 27138065
1-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-(2-fluorophenyl)thiourea (PubChem CID 27138065) has the molecular formula C15H19FN2S and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 27138065 |
| Molecular Formula | C15H19FN2S |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-[[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]methyl]-3-(2-fluorophenyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)NC[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C15H19FN2S/c16-13-3-1-2-4-14(13)18-15(19)17-9-12-8-10-5-6-11(12)7-10/h1-4,10-12H,5-9H2,(H2,17,18,19)/t10-,11+,12-/m0/s1 |
| InChIKey | HOYMWKCTNPPLKR-TUAOUCFPSA-N |
| XLogP | 3.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|