C16H27NO4 — CID 122597632
2-[2-(2-bicyclo[2.2.1]heptanylmethylamino)oxyethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 122597632) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-[2-(2-bicyclo[2.2.1]heptanylmethylamino)oxyethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(2-bicyclo[2.2.1]heptanylmethylamino)oxyethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122597632 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-[2-(2-bicyclo[2.2.1]heptanylmethylamino)oxyethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCONCC1CC2CCC1C2 |
| InChI | InChI=1S/C16H27NO4/c1-12(2)16(18)20-7-5-19-6-8-21-17-11-15-10-13-3-4-14(15)9-13/h13-15,17H,1,3-11H2,2H3 |
| InChIKey | CZEFDKVGDVGZFU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|