C9H15FO3S — CID 123733478
1-(2-bicyclo[2.2.1]heptanyl)-1-fluoroethanesulfonic acid (PubChem CID 123733478) has the molecular formula C9H15FO3S and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-1-fluoroethanesulfonic acid.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-1-fluoroethanesulfonic acid |
|---|---|
| PubChem CID | 123733478 |
| Molecular Formula | C9H15FO3S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-1-fluoroethanesulfonic acid |
| SMILES | CC(F)(C1CC2CCC1C2)S(=O)(=O)O |
| InChI | InChI=1S/C9H15FO3S/c1-9(10,14(11,12)13)8-5-6-2-3-7(8)4-6/h6-8H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | VJAMIPDSGITXBF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|