C9H11F4NaO3S — CID 59514422
sodium 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 59514422) has the molecular formula C9H11F4NaO3S and a molecular weight of 298.23 g/mol. Its IUPAC name is sodium 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | sodium 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 59514422 |
| Molecular Formula | C9H11F4NaO3S |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | sodium 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C1CC2CCC1C2.[Na+] |
| InChI | InChI=1S/C9H12F4O3S.Na/c10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5;/h5-7H,1-4H2,(H,14,15,16);/q;+1/p-1 |
| InChIKey | JXOZYYYEKZPLDW-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|