C31H35F4O3PS — CID 159102390
2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;(4-tert-butylphenyl)-diphenylphosphanium (PubChem CID 159102390) has the molecular formula C31H35F4O3PS and a molecular weight of 594.65 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;(4-tert-butylphenyl)-diphenylphosphanium.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;(4-tert-butylphenyl)-diphenylphosphanium |
|---|---|
| PubChem CID | 159102390 |
| Molecular Formula | C31H35F4O3PS |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate;(4-tert-butylphenyl)-diphenylphosphanium |
| SMILES | CC(C)(C)c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C22H23P.C9H12F4O3S/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5/h4-17H,1-3H3;5-7H,1-4H2,(H,14,15,16) |
| InChIKey | KDLJCCKQPPDYLU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|