C28H29F4O5PS2 — CID 171922847
2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;(4-methylsulfonylphenyl)-diphenylphosphane (PubChem CID 171922847) has the molecular formula C28H29F4O5PS2 and a molecular weight of 616.64 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;(4-methylsulfonylphenyl)-diphenylphosphane.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;(4-methylsulfonylphenyl)-diphenylphosphane |
|---|---|
| PubChem CID | 171922847 |
| Molecular Formula | C28H29F4O5PS2 |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonic acid;(4-methylsulfonylphenyl)-diphenylphosphane |
| SMILES | CS(=O)(=O)c1ccc(P(c2ccccc2)c2ccccc2)cc1.O=S(=O)(O)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C19H17O2PS.C9H12F4O3S/c1-23(20,21)19-14-12-18(13-15-19)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17;10-8(11,9(12,13)17(14,15)16)7-4-5-1-2-6(7)3-5/h2-15H,1H3;5-7H,1-4H2,(H,14,15,16) |
| InChIKey | KFKUAHHEGZANJE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|