C29H32F2O5S2 — CID 87656005
2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-1,1-difluoroethanesulfonic acid;methyl(triphenyl)-λ4-sulfane (PubChem CID 87656005) has the molecular formula C29H32F2O5S2 and a molecular weight of 562.70 g/mol. Its IUPAC name is 2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-1,1-difluoroethanesulfonic acid;methyl(triphenyl)-λ4-sulfane.
| Compound Name | 2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-1,1-difluoroethanesulfonic acid;methyl(triphenyl)-λ4-sulfane |
|---|---|
| PubChem CID | 87656005 |
| Molecular Formula | C29H32F2O5S2 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 2-(bicyclo[2.2.1]heptane-2-carbonyloxy)-1,1-difluoroethanesulfonic acid;methyl(triphenyl)-λ4-sulfane |
| SMILES | CS(c1ccccc1)(c1ccccc1)c1ccccc1.O=C(OCC(F)(F)S(=O)(=O)O)C1CC2CCC1C2 |
| InChI | InChI=1S/C19H18S.C10H14F2O5S/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;11-10(12,18(14,15)16)5-17-9(13)8-4-6-1-2-7(8)3-6/h2-16H,1H3;6-8H,1-5H2,(H,14,15,16) |
| InChIKey | FJBYADWOUUVADN-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|