C14H22F2O5S — CID 166978115
2-(3-ethylbicyclo[3.3.1]nonane-2-carbonyl)oxy-1,1-difluoroethanesulfonic acid (PubChem CID 166978115) has the molecular formula C14H22F2O5S and a molecular weight of 340.39 g/mol. Its IUPAC name is 2-(3-ethylbicyclo[3.3.1]nonane-2-carbonyl)oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-(3-ethylbicyclo[3.3.1]nonane-2-carbonyl)oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 166978115 |
| Molecular Formula | C14H22F2O5S |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(3-ethylbicyclo[3.3.1]nonane-2-carbonyl)oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CCC1CC2CCCC(C2)C1C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H22F2O5S/c1-2-10-6-9-4-3-5-11(7-9)12(10)13(17)21-8-14(15,16)22(18,19)20/h9-12H,2-8H2,1H3,(H,18,19,20) |
| InChIKey | YYBONMDIJYTVKC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|