C18H16F2I3NO7S — CID 167388306
1,1-difluoro-2-[3-[(2,3,5-triiodobenzoyl)carbamoyl]bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonic acid (PubChem CID 167388306) has the molecular formula C18H16F2I3NO7S and a molecular weight of 809.10 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-[(2,3,5-triiodobenzoyl)carbamoyl]bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-[(2,3,5-triiodobenzoyl)carbamoyl]bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 167388306 |
| Molecular Formula | C18H16F2I3NO7S |
| Molecular Weight | 809.10 g/mol |
| Exact Mass | 808.77 |
| IUPAC Name | 1,1-difluoro-2-[3-[(2,3,5-triiodobenzoyl)carbamoyl]bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C(NC(=O)C1C2CCC(C2)C1C(=O)OCC(F)(F)S(=O)(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C18H16F2I3NO7S/c19-18(20,32(28,29)30)6-31-17(27)13-8-2-1-7(3-8)12(13)16(26)24-15(25)10-4-9(21)5-11(22)14(10)23/h4-5,7-8,12-13H,1-3,6H2,(H,24,25,26)(H,28,29,30) |
| InChIKey | DSYDQFVTTZIYFS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|