C19H12F2I3NO11S — CID 166044340
1,1-difluoro-2-[5-nitro-2-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzoyl]oxyethanesulfonic acid (PubChem CID 166044340) has the molecular formula C19H12F2I3NO11S and a molecular weight of 881.08 g/mol. Its IUPAC name is 1,1-difluoro-2-[5-nitro-2-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[5-nitro-2-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 166044340 |
| Molecular Formula | C19H12F2I3NO11S |
| Molecular Weight | 881.08 g/mol |
| Exact Mass | 880.72 |
| IUPAC Name | 1,1-difluoro-2-[5-nitro-2-[2-(2,3,5-triiodobenzoyl)oxyethoxycarbonyl]benzoyl]oxyethanesulfonic acid |
| SMILES | O=C(OCCOC(=O)c1cc(I)cc(I)c1I)c1ccc([N+](=O)[O-])cc1C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C19H12F2I3NO11S/c20-19(21,37(31,32)33)8-36-17(27)12-7-10(25(29)30)1-2-11(12)16(26)34-3-4-35-18(28)13-5-9(22)6-14(23)15(13)24/h1-2,5-7H,3-4,8H2,(H,31,32,33) |
| InChIKey | LGTKUTKIZPBRPD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 176.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.08 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|