C9H6F2I2O6S — CID 176755639
1,1-difluoro-2-(5-hydroxy-2,4-diiodobenzoyl)oxyethanesulfonic acid (PubChem CID 176755639) has the molecular formula C9H6F2I2O6S and a molecular weight of 534.01 g/mol. Its IUPAC name is 1,1-difluoro-2-(5-hydroxy-2,4-diiodobenzoyl)oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(5-hydroxy-2,4-diiodobenzoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 176755639 |
| Molecular Formula | C9H6F2I2O6S |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.79 |
| IUPAC Name | 1,1-difluoro-2-(5-hydroxy-2,4-diiodobenzoyl)oxyethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1cc(O)c(I)cc1I |
| InChI | InChI=1S/C9H6F2I2O6S/c10-9(11,20(16,17)18)3-19-8(15)4-1-7(14)6(13)2-5(4)12/h1-2,14H,3H2,(H,16,17,18) |
| InChIKey | BVCSLGXKEJAEBU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|