C17H8F6I2O8S — CID 174259231
1,1-difluoro-2-[2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoyl]oxyethanesulfonic acid (PubChem CID 174259231) has the molecular formula C17H8F6I2O8S and a molecular weight of 740.11 g/mol. Its IUPAC name is 1,1-difluoro-2-[2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 174259231 |
| Molecular Formula | C17H8F6I2O8S |
| Molecular Weight | 740.11 g/mol |
| Exact Mass | 739.79 |
| IUPAC Name | 1,1-difluoro-2-[2,3,4,5-tetrafluoro-6-[(2-hydroxy-3,5-diiodophenyl)methoxycarbonyl]benzoyl]oxyethanesulfonic acid |
| SMILES | O=C(OCc1cc(I)cc(I)c1O)c1c(F)c(F)c(F)c(F)c1C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H8F6I2O8S/c18-10-8(15(27)32-3-5-1-6(24)2-7(25)14(5)26)9(11(19)13(21)12(10)20)16(28)33-4-17(22,23)34(29,30)31/h1-2,26H,3-4H2,(H,29,30,31) |
| InChIKey | JTSZBPKBGSFLRR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.11 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|