C15H16F2I3NO6S — CID 167388433
2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonic acid (PubChem CID 167388433) has the molecular formula C15H16F2I3NO6S and a molecular weight of 757.07 g/mol. Its IUPAC name is 2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 167388433 |
| Molecular Formula | C15H16F2I3NO6S |
| Molecular Weight | 757.07 g/mol |
| Exact Mass | 756.78 |
| IUPAC Name | 2-[4-[ethyl-(2,3,5-triiodobenzoyl)amino]butanoyloxy]-1,1-difluoroethanesulfonic acid |
| SMILES | CCN(CCCC(=O)OCC(F)(F)S(=O)(=O)O)C(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C15H16F2I3NO6S/c1-2-21(14(23)10-6-9(18)7-11(19)13(10)20)5-3-4-12(22)27-8-15(16,17)28(24,25)26/h6-7H,2-5,8H2,1H3,(H,24,25,26) |
| InChIKey | UIDWSAHLWCAALF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.07 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|