C13H14I3NO3 — CID 63408722
methyl 4-[methyl-(2,3,5-triiodobenzoyl)amino]butanoate (PubChem CID 63408722) has the molecular formula C13H14I3NO3 and a molecular weight of 612.97 g/mol. Its IUPAC name is methyl 4-[methyl-(2,3,5-triiodobenzoyl)amino]butanoate.
| Compound Name | methyl 4-[methyl-(2,3,5-triiodobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 63408722 |
| Molecular Formula | C13H14I3NO3 |
| Molecular Weight | 612.97 g/mol |
| Exact Mass | 612.81 |
| IUPAC Name | methyl 4-[methyl-(2,3,5-triiodobenzoyl)amino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C13H14I3NO3/c1-17(5-3-4-11(18)20-2)13(19)9-6-8(14)7-10(15)12(9)16/h6-7H,3-5H2,1-2H3 |
| InChIKey | WIAYKTCFMCMIAT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.97 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|