methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate

C15H22N2O3 — CID 102705214

IUPACmethyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate
SMILESCOC(=O)CCCN(C)C(=O)c1cc(N)c(C)cc1C
InChIInChI=1S/C15H22N2O3/c1-10-8-11(2)13(16)9-12(10)15(19)17(3)7-5-6-14(18)20-4/h8-9H,5-7,16H2,1-4H3
InChIKeyKVSDICFLKJGKEI-UHFFFAOYSA-N
MW278.35 g/mol
LogP1.91
Rot. Bonds5

About methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate

methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate (PubChem CID 102705214) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate.

Molecular Properties

Compound Namemethyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate
PubChem CID102705214
Molecular FormulaC15H22N2O3
Molecular Weight278.35 g/mol
Exact Mass278.16
IUPAC Namemethyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate
SMILESCOC(=O)CCCN(C)C(=O)c1cc(N)c(C)cc1C
InChIInChI=1S/C15H22N2O3/c1-10-8-11(2)13(16)9-12(10)15(19)17(3)7-5-6-14(18)20-4/h8-9H,5-7,16H2,1-4H3
InChIKeyKVSDICFLKJGKEI-UHFFFAOYSA-N
XLogP1.91
TPSA72.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate?
The IUPAC name of methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate (CID 102705214) is methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate.
What is the SMILES notation for methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate?
The canonical SMILES for methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate is COC(=O)CCCN(C)C(=O)c1cc(N)c(C)cc1C.
What is the InChIKey of methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate?
The InChIKey is KVSDICFLKJGKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-10-8-11(2)13(16)9-12(10)15(19)17(3)7-5-6-14(18)20-4/h8-9H,5-7,16H2,1-4H3.
What are the key properties of methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate?
methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate has a molecular weight of 278.35 g/mol, XLogP of 1.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(5-amino-2,4-dimethylbenzoyl)-methylamino]butanoate is sourced from PubChem (CID 102705214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).