C15H21NO3 — CID 54943241
methyl 4-[(2,3-dimethylbenzoyl)-methylamino]butanoate (PubChem CID 54943241) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl 4-[(2,3-dimethylbenzoyl)-methylamino]butanoate.
| Compound Name | methyl 4-[(2,3-dimethylbenzoyl)-methylamino]butanoate |
|---|---|
| PubChem CID | 54943241 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl 4-[(2,3-dimethylbenzoyl)-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C15H21NO3/c1-11-7-5-8-13(12(11)2)15(18)16(3)10-6-9-14(17)19-4/h5,7-8H,6,9-10H2,1-4H3 |
| InChIKey | UDMLTXBDRINBCJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |