C16H18FNO3S — CID 51112265
methyl 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoate (PubChem CID 51112265) has the molecular formula C16H18FNO3S and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoate.
| Compound Name | methyl 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoate |
|---|---|
| PubChem CID | 51112265 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)C(=O)c1sc2cccc(F)c2c1C |
| InChI | InChI=1S/C16H18FNO3S/c1-10-14-11(17)6-4-7-12(14)22-15(10)16(20)18(2)9-5-8-13(19)21-3/h4,6-7H,5,8-9H2,1-3H3 |
| InChIKey | YBGHTUKFPSSQGW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |