C15H16FNO3S — CID 43359947
4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoic acid (PubChem CID 43359947) has the molecular formula C15H16FNO3S and a molecular weight of 309.36 g/mol. Its IUPAC name is 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoic acid.
| Compound Name | 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 43359947 |
| Molecular Formula | C15H16FNO3S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[(4-fluoro-3-methyl-1-benzothiophene-2-carbonyl)-methylamino]butanoic acid |
| SMILES | Cc1c(C(=O)N(C)CCCC(=O)O)sc2cccc(F)c12 |
| InChI | InChI=1S/C15H16FNO3S/c1-9-13-10(16)5-3-6-11(13)21-14(9)15(20)17(2)8-4-7-12(18)19/h3,5-6H,4,7-8H2,1-2H3,(H,18,19) |
| InChIKey | TVJQAVSVXODSIA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |