C16H18FNO2S — CID 102684363
N-cyclobutyl-4-fluoro-N-(2-hydroxyethyl)-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 102684363) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is N-cyclobutyl-4-fluoro-N-(2-hydroxyethyl)-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-cyclobutyl-4-fluoro-N-(2-hydroxyethyl)-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 102684363 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-cyclobutyl-4-fluoro-N-(2-hydroxyethyl)-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)N(CCO)C2CCC2)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H18FNO2S/c1-10-14-12(17)6-3-7-13(14)21-15(10)16(20)18(8-9-19)11-4-2-5-11/h3,6-7,11,19H,2,4-5,8-9H2,1H3 |
| InChIKey | INBKUCHKRXHSAT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |