C10H6FO2S- — CID 7129158
4-fluoro-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 7129158) has the molecular formula C10H6FO2S- and a molecular weight of 209.22 g/mol. Its IUPAC name is 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7129158 |
| Molecular Formula | C10H6FO2S- |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)[O-])sc2cccc(F)c12 |
| InChI | InChI=1S/C10H7FO2S/c1-5-8-6(11)3-2-4-7(8)14-9(5)10(12)13/h2-4H,1H3,(H,12,13)/p-1 |
| InChIKey | SLKHVQZFOWEYQS-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |