C16H18FNO3S — CID 9062165
[2-(tert-butylamino)-2-oxoethyl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 9062165) has the molecular formula C16H18FNO3S and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 9062165 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 4-fluoro-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | Cc1c(C(=O)OCC(=O)NC(C)(C)C)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H18FNO3S/c1-9-13-10(17)6-5-7-11(13)22-14(9)15(20)21-8-12(19)18-16(2,3)4/h5-7H,8H2,1-4H3,(H,18,19) |
| InChIKey | MSXLDZCHYFSSPB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |